Benzene and substituted derivatives
Filtered Search Results
3-Bromoanisole 98.0+%, TCI America™
CAS: 2398-37-0 Molecular Formula: C7H7BrO Molecular Weight (g/mol): 187.04 MDL Number: MFCD00000081 InChI Key: PLDWAJLZAAHOGG-UHFFFAOYSA-N Synonym: 3-bromoanisole,m-bromoanisole,3-methoxybromobenzene,3-bromo anisole,m-bromomethoxybenzene,benzene, 1-bromo-3-methoxy,anisole, m-bromo,3-methoxy-1-bromobenzene,m-methoxybromobenzene,meta-bromoanisole PubChem CID: 16971 IUPAC Name: 1-bromo-3-methoxybenzene SMILES: COC1=CC=CC(Br)=C1
| PubChem CID | 16971 |
|---|---|
| CAS | 2398-37-0 |
| Molecular Weight (g/mol) | 187.04 |
| MDL Number | MFCD00000081 |
| SMILES | COC1=CC=CC(Br)=C1 |
| Synonym | 3-bromoanisole,m-bromoanisole,3-methoxybromobenzene,3-bromo anisole,m-bromomethoxybenzene,benzene, 1-bromo-3-methoxy,anisole, m-bromo,3-methoxy-1-bromobenzene,m-methoxybromobenzene,meta-bromoanisole |
| IUPAC Name | 1-bromo-3-methoxybenzene |
| InChI Key | PLDWAJLZAAHOGG-UHFFFAOYSA-N |
| Molecular Formula | C7H7BrO |
Benzyltriphenylphosphonium Chloride 98.0+%, TCI America™
CAS: 1100-88-5 Molecular Formula: C25H22ClP Molecular Weight (g/mol): 388.87 MDL Number: MFCD00011913 InChI Key: USFRYJRPHFMVBZ-UHFFFAOYSA-M Synonym: benzyltriphenylphosphonium chloride,triphenylbenzylphosphonium chloride,phosphonium, triphenyl phenylmethyl-, chloride,benzyltriphenylphosphanium chloride,benzyl triphenylphosphonium chloride,benzyl-triphenyl-phosphonium chloride,phosphonium, triphenyl phenylmethyl-, chloride 1:1,triphenylbenzylphosphine, chloride,benzyl triphenyl phosphoniumchlorid PubChem CID: 70671 IUPAC Name: benzyltriphenylphosphanium chloride SMILES: [Cl-].C(C1=CC=CC=C1)[P+](C1=CC=CC=C1)(C1=CC=CC=C1)C1=CC=CC=C1
| PubChem CID | 70671 |
|---|---|
| CAS | 1100-88-5 |
| Molecular Weight (g/mol) | 388.87 |
| MDL Number | MFCD00011913 |
| SMILES | [Cl-].C(C1=CC=CC=C1)[P+](C1=CC=CC=C1)(C1=CC=CC=C1)C1=CC=CC=C1 |
| Synonym | benzyltriphenylphosphonium chloride,triphenylbenzylphosphonium chloride,phosphonium, triphenyl phenylmethyl-, chloride,benzyltriphenylphosphanium chloride,benzyl triphenylphosphonium chloride,benzyl-triphenyl-phosphonium chloride,phosphonium, triphenyl phenylmethyl-, chloride 1:1,triphenylbenzylphosphine, chloride,benzyl triphenyl phosphoniumchlorid |
| IUPAC Name | benzyltriphenylphosphanium chloride |
| InChI Key | USFRYJRPHFMVBZ-UHFFFAOYSA-M |
| Molecular Formula | C25H22ClP |
3,5-Bis(trifluoromethyl)benzenesulfonyl Chloride 98.0+%, TCI America™
CAS: 39234-86-1 Molecular Formula: C8H3ClF6O2S Molecular Weight (g/mol): 312.61 MDL Number: MFCD00014725 InChI Key: BTRCVKADYDVSLI-UHFFFAOYSA-N Synonym: 3,5-bis trifluoromethyl benzenesulfonyl chloride,3,5-bis trifluoromethyl benzene-1-sulfonyl chloride,3,5-bis trifluoromethyl benzenesulphonyl chloride,3,5-di trifluoromethyl benzene-1-sulfonyl chloride,3,5-ditrifluoromethylbenzenesulfonyl chloride,benzenesulfonyl chloride, 3,5-bis trifluoromethyl,3,5-bis trifluoromethyl phenylsulfonyl chloride,3,5-bis-trifluoromethyl-benzenesulfonyl chloride,3,5-di trifluoromethyl benzene sulfonyl chloride,pubchem2724 PubChem CID: 520945 IUPAC Name: 3,5-bis(trifluoromethyl)benzenesulfonyl chloride SMILES: C1=C(C=C(C=C1C(F)(F)F)S(=O)(=O)Cl)C(F)(F)F
| PubChem CID | 520945 |
|---|---|
| CAS | 39234-86-1 |
| Molecular Weight (g/mol) | 312.61 |
| MDL Number | MFCD00014725 |
| SMILES | C1=C(C=C(C=C1C(F)(F)F)S(=O)(=O)Cl)C(F)(F)F |
| Synonym | 3,5-bis trifluoromethyl benzenesulfonyl chloride,3,5-bis trifluoromethyl benzene-1-sulfonyl chloride,3,5-bis trifluoromethyl benzenesulphonyl chloride,3,5-di trifluoromethyl benzene-1-sulfonyl chloride,3,5-ditrifluoromethylbenzenesulfonyl chloride,benzenesulfonyl chloride, 3,5-bis trifluoromethyl,3,5-bis trifluoromethyl phenylsulfonyl chloride,3,5-bis-trifluoromethyl-benzenesulfonyl chloride,3,5-di trifluoromethyl benzene sulfonyl chloride,pubchem2724 |
| IUPAC Name | 3,5-bis(trifluoromethyl)benzenesulfonyl chloride |
| InChI Key | BTRCVKADYDVSLI-UHFFFAOYSA-N |
| Molecular Formula | C8H3ClF6O2S |
Quinoxyfen 98.0+%, TCI America™
CAS: 124495-18-7 Molecular Formula: C15H8Cl2FNO Molecular Weight (g/mol): 308.13 MDL Number: MFCD03265638 InChI Key: WRPIRSINYZBGPK-UHFFFAOYSA-N Synonym: quinoxyfen,5,7-dichloro-4-4-fluorophenoxy quinoline,legend,quinoline, 5,7-dichloro-4-4-fluorophenoxy,unii-ppc78j1vcw,quinoxyfen iso:bsi:ansi,ppc78j1vcw,5,7-dichloro-4-quinolyl 4-fluorophenyl ether,acmc-20mr2i,dsstox_cid_14881 PubChem CID: 3391107 ChEBI: CHEBI:82040 IUPAC Name: 5,7-dichloro-4-(4-fluorophenoxy)quinoline SMILES: FC1=CC=C(OC2=C3C(Cl)=CC(Cl)=CC3=NC=C2)C=C1
| PubChem CID | 3391107 |
|---|---|
| CAS | 124495-18-7 |
| Molecular Weight (g/mol) | 308.13 |
| ChEBI | CHEBI:82040 |
| MDL Number | MFCD03265638 |
| SMILES | FC1=CC=C(OC2=C3C(Cl)=CC(Cl)=CC3=NC=C2)C=C1 |
| Synonym | quinoxyfen,5,7-dichloro-4-4-fluorophenoxy quinoline,legend,quinoline, 5,7-dichloro-4-4-fluorophenoxy,unii-ppc78j1vcw,quinoxyfen iso:bsi:ansi,ppc78j1vcw,5,7-dichloro-4-quinolyl 4-fluorophenyl ether,acmc-20mr2i,dsstox_cid_14881 |
| IUPAC Name | 5,7-dichloro-4-(4-fluorophenoxy)quinoline |
| InChI Key | WRPIRSINYZBGPK-UHFFFAOYSA-N |
| Molecular Formula | C15H8Cl2FNO |
Phenoxyacetic Anhydride 98.0+%, TCI America™
CAS: 14316-61-1 Molecular Formula: C16H14O5 Molecular Weight (g/mol): 286.283 MDL Number: MFCD00059681 InChI Key: CCSBNBKMACZDGN-UHFFFAOYSA-N PubChem CID: 318938 IUPAC Name: (2-phenoxyacetyl) 2-phenoxyacetate SMILES: C1=CC=C(C=C1)OCC(=O)OC(=O)COC2=CC=CC=C2
| PubChem CID | 318938 |
|---|---|
| CAS | 14316-61-1 |
| Molecular Weight (g/mol) | 286.283 |
| MDL Number | MFCD00059681 |
| SMILES | C1=CC=C(C=C1)OCC(=O)OC(=O)COC2=CC=CC=C2 |
| IUPAC Name | (2-phenoxyacetyl) 2-phenoxyacetate |
| InChI Key | CCSBNBKMACZDGN-UHFFFAOYSA-N |
| Molecular Formula | C16H14O5 |
4-Fluoro-2-nitrobenzoic Acid 98.0+%, TCI America™
CAS: 394-01-4 Molecular Formula: C7H4FNO4 Molecular Weight (g/mol): 185.11 MDL Number: MFCD00024300 InChI Key: YLUCXHMYRQUERW-UHFFFAOYSA-N Synonym: 4-fluoro-2-nitrobenzoic acid,2-nitro-4-fluorobenzoic acid,4-fluoro-2-nitrobenzoicacid,benzoic acid, 4-fluoro-2-nitro,4-fluoro-2-nitro-benzoic acid,4-fluoro-2-nitrobenzoic acid 2-nitro-4-fluorobenzoic acid,pubchem1311,acmc-1aim5,ksc497m7t,2-carboxy-5-fluoronitrobenzene PubChem CID: 2737416 SMILES: C1=CC(=C(C=C1F)[N+](=O)[O-])C(=O)O
| PubChem CID | 2737416 |
|---|---|
| CAS | 394-01-4 |
| Molecular Weight (g/mol) | 185.11 |
| MDL Number | MFCD00024300 |
| SMILES | C1=CC(=C(C=C1F)[N+](=O)[O-])C(=O)O |
| Synonym | 4-fluoro-2-nitrobenzoic acid,2-nitro-4-fluorobenzoic acid,4-fluoro-2-nitrobenzoicacid,benzoic acid, 4-fluoro-2-nitro,4-fluoro-2-nitro-benzoic acid,4-fluoro-2-nitrobenzoic acid 2-nitro-4-fluorobenzoic acid,pubchem1311,acmc-1aim5,ksc497m7t,2-carboxy-5-fluoronitrobenzene |
| InChI Key | YLUCXHMYRQUERW-UHFFFAOYSA-N |
| Molecular Formula | C7H4FNO4 |
3-Fluoro-4-(trifluoromethyl)benzoic Acid 98.0+%, TCI America™
CAS: 115754-21-7 Molecular Formula: C8H4F4O2 Molecular Weight (g/mol): 208.112 MDL Number: MFCD00236279 InChI Key: HRIHSNPFVGMAKX-UHFFFAOYSA-N Synonym: 3-fluoro-4-trifluoromethyl benzoic acid,benzoic acid, 3-fluoro-4-trifluoromethyl,alpha,alpha,alpha,3-tetrafluoro-p-toluic acid,pubchem4970,acmc-1c70e,ksc179k4t,3-fluoro-4 trifluoromethyl benzoic acid,3-fluoro-4-trifluoromethyl-benzoic acid,3-fluoro-4-trifluoromethyl benzoicacid,3-fluoro-4-trifluoromethyl benzoic aicd PubChem CID: 688293 IUPAC Name: 3-fluoro-4-(trifluoromethyl)benzoic acid SMILES: C1=CC(=C(C=C1C(=O)O)F)C(F)(F)F
| PubChem CID | 688293 |
|---|---|
| CAS | 115754-21-7 |
| Molecular Weight (g/mol) | 208.112 |
| MDL Number | MFCD00236279 |
| SMILES | C1=CC(=C(C=C1C(=O)O)F)C(F)(F)F |
| Synonym | 3-fluoro-4-trifluoromethyl benzoic acid,benzoic acid, 3-fluoro-4-trifluoromethyl,alpha,alpha,alpha,3-tetrafluoro-p-toluic acid,pubchem4970,acmc-1c70e,ksc179k4t,3-fluoro-4 trifluoromethyl benzoic acid,3-fluoro-4-trifluoromethyl-benzoic acid,3-fluoro-4-trifluoromethyl benzoicacid,3-fluoro-4-trifluoromethyl benzoic aicd |
| IUPAC Name | 3-fluoro-4-(trifluoromethyl)benzoic acid |
| InChI Key | HRIHSNPFVGMAKX-UHFFFAOYSA-N |
| Molecular Formula | C8H4F4O2 |
Tetrafluoroterephthalic Acid 97.0+%, TCI America™
CAS: 652-36-8 Molecular Formula: C8H2F4O4 Molecular Weight (g/mol): 238.09 MDL Number: MFCD00012301 InChI Key: WFNRNCNCXRGUKN-UHFFFAOYSA-N PubChem CID: 69549 IUPAC Name: tetrafluorobenzene-1,4-dicarboxylic acid SMILES: OC(=O)C1=C(F)C(F)=C(C(O)=O)C(F)=C1F
| PubChem CID | 69549 |
|---|---|
| CAS | 652-36-8 |
| Molecular Weight (g/mol) | 238.09 |
| MDL Number | MFCD00012301 |
| SMILES | OC(=O)C1=C(F)C(F)=C(C(O)=O)C(F)=C1F |
| IUPAC Name | tetrafluorobenzene-1,4-dicarboxylic acid |
| InChI Key | WFNRNCNCXRGUKN-UHFFFAOYSA-N |
| Molecular Formula | C8H2F4O4 |
2,4,6-Tris(3,4,5-trifluorophenyl)boroxin 98.0+%, TCI America™
CAS: 223440-94-6 Molecular Formula: C18H6B3F9O3 Molecular Weight (g/mol): 473.659 MDL Number: MFCD03844809 InChI Key: SXINGRFBONUWIF-UHFFFAOYSA-N Synonym: 3,4,5-Trifluorophenylboronic Anhydride, Tris(3,4,5-trifluorophenyl)cycloboroxane PubChem CID: 20654586 IUPAC Name: 2,4,6-tris(3,4,5-trifluorophenyl)-1,3,5,2,4,6-trioxatriborinane SMILES: B1(OB(OB(O1)C2=CC(=C(C(=C2)F)F)F)C3=CC(=C(C(=C3)F)F)F)C4=CC(=C(C(=C4)F)F)F
| PubChem CID | 20654586 |
|---|---|
| CAS | 223440-94-6 |
| Molecular Weight (g/mol) | 473.659 |
| MDL Number | MFCD03844809 |
| SMILES | B1(OB(OB(O1)C2=CC(=C(C(=C2)F)F)F)C3=CC(=C(C(=C3)F)F)F)C4=CC(=C(C(=C4)F)F)F |
| Synonym | 3,4,5-Trifluorophenylboronic Anhydride, Tris(3,4,5-trifluorophenyl)cycloboroxane |
| IUPAC Name | 2,4,6-tris(3,4,5-trifluorophenyl)-1,3,5,2,4,6-trioxatriborinane |
| InChI Key | SXINGRFBONUWIF-UHFFFAOYSA-N |
| Molecular Formula | C18H6B3F9O3 |
5,8-Dibromo-2,3-bis(4-methoxyphenyl)quinoxaline 98.0+%, TCI America™
CAS: 162967-90-0 Molecular Formula: C22H16Br2N2O2 Molecular Weight (g/mol): 500.19 InChI Key: PEHOANSJGUIQOF-UHFFFAOYSA-N PubChem CID: 57712549 IUPAC Name: 5,8-dibromo-2,3-bis(4-methoxyphenyl)quinoxaline SMILES: COC1=CC=C(C=C1)C2=NC3=C(C=CC(=C3N=C2C4=CC=C(C=C4)OC)Br)Br
| PubChem CID | 57712549 |
|---|---|
| CAS | 162967-90-0 |
| Molecular Weight (g/mol) | 500.19 |
| SMILES | COC1=CC=C(C=C1)C2=NC3=C(C=CC(=C3N=C2C4=CC=C(C=C4)OC)Br)Br |
| IUPAC Name | 5,8-dibromo-2,3-bis(4-methoxyphenyl)quinoxaline |
| InChI Key | PEHOANSJGUIQOF-UHFFFAOYSA-N |
| Molecular Formula | C22H16Br2N2O2 |
5-Fluoro-2-nitroanisole 98.0+%, TCI America™
CAS: 448-19-1 Molecular Formula: C7H6FNO3 Molecular Weight (g/mol): 171.127 MDL Number: MFCD00077541 InChI Key: WLKUSVNHZXUEFO-UHFFFAOYSA-N Synonym: 4-Fluoro-2-methoxy-1-nitrobenzene PubChem CID: 2779250 IUPAC Name: 4-fluoro-2-methoxy-1-nitrobenzene SMILES: COC1=C(C=CC(=C1)F)[N+](=O)[O-]
| PubChem CID | 2779250 |
|---|---|
| CAS | 448-19-1 |
| Molecular Weight (g/mol) | 171.127 |
| MDL Number | MFCD00077541 |
| SMILES | COC1=C(C=CC(=C1)F)[N+](=O)[O-] |
| Synonym | 4-Fluoro-2-methoxy-1-nitrobenzene |
| IUPAC Name | 4-fluoro-2-methoxy-1-nitrobenzene |
| InChI Key | WLKUSVNHZXUEFO-UHFFFAOYSA-N |
| Molecular Formula | C7H6FNO3 |
4-Bromobenzoic Acid 98.0+%, TCI America™
CAS: 586-76-5 Molecular Formula: C7H5BrO2 Molecular Weight (g/mol): 201.02 MDL Number: MFCD00002529 InChI Key: TUXYZHVUPGXXQG-UHFFFAOYSA-N Synonym: p-bromobenzoic acid,benzoic acid, 4-bromo,p-carboxybromobenzene,benzoic acid, p-bromo,p-bromobenzenecarboxylic acid,4-bromo-benzoic acid,4-brom-benzoesaeure,4-carboxybromobenzene,para bromo benzoic acid,4bromo-benzoic acid PubChem CID: 11464 ChEBI: CHEBI:60698 IUPAC Name: 4-bromobenzoic acid SMILES: OC(=O)C1=CC=C(Br)C=C1
| PubChem CID | 11464 |
|---|---|
| CAS | 586-76-5 |
| Molecular Weight (g/mol) | 201.02 |
| ChEBI | CHEBI:60698 |
| MDL Number | MFCD00002529 |
| SMILES | OC(=O)C1=CC=C(Br)C=C1 |
| Synonym | p-bromobenzoic acid,benzoic acid, 4-bromo,p-carboxybromobenzene,benzoic acid, p-bromo,p-bromobenzenecarboxylic acid,4-bromo-benzoic acid,4-brom-benzoesaeure,4-carboxybromobenzene,para bromo benzoic acid,4bromo-benzoic acid |
| IUPAC Name | 4-bromobenzoic acid |
| InChI Key | TUXYZHVUPGXXQG-UHFFFAOYSA-N |
| Molecular Formula | C7H5BrO2 |
beta-Bromostyrene (cis- and trans- mixture) 95.0+%, TCI America™
CAS: 103-64-0 Molecular Formula: C8H7Br Molecular Weight (g/mol): 183.048 MDL Number: MFCD00000185 InChI Key: YMOONIIMQBGTDU-VOTSOKGWSA-N Synonym: 2-bromovinyl benzene,beta-bromostyrene,styryl bromide,2-bromoethenyl benzene,bromostyrolene,1-bromo-2-phenylethene,bromostyrol,bromstyrole,hyacinth base,1-bromo-2-phenylethylene PubChem CID: 5314126 IUPAC Name: [(E)-2-bromoethenyl]benzene SMILES: C1=CC=C(C=C1)C=CBr
| PubChem CID | 5314126 |
|---|---|
| CAS | 103-64-0 |
| Molecular Weight (g/mol) | 183.048 |
| MDL Number | MFCD00000185 |
| SMILES | C1=CC=C(C=C1)C=CBr |
| Synonym | 2-bromovinyl benzene,beta-bromostyrene,styryl bromide,2-bromoethenyl benzene,bromostyrolene,1-bromo-2-phenylethene,bromostyrol,bromstyrole,hyacinth base,1-bromo-2-phenylethylene |
| IUPAC Name | [(E)-2-bromoethenyl]benzene |
| InChI Key | YMOONIIMQBGTDU-VOTSOKGWSA-N |
| Molecular Formula | C8H7Br |
sec-Butylbenzene 99.0+%, TCI America™
CAS: 135-98-8 Molecular Formula: C10H14 Molecular Weight (g/mol): 134.222 MDL Number: MFCD00009329 InChI Key: ZJMWRROPUADPEA-UHFFFAOYSA-N Synonym: sec-butylbenzene,2-phenylbutane,1-methylpropyl benzene,secondary butylbenzene,benzene, 1-methylpropyl,s-butylbenzene,benzene, sec-butyl,1-sec-butylbenzene,methylpropyl benzene,secbutylbenzene PubChem CID: 8680 ChEBI: CHEBI:35097 IUPAC Name: butan-2-ylbenzene SMILES: CCC(C)C1=CC=CC=C1
| PubChem CID | 8680 |
|---|---|
| CAS | 135-98-8 |
| Molecular Weight (g/mol) | 134.222 |
| ChEBI | CHEBI:35097 |
| MDL Number | MFCD00009329 |
| SMILES | CCC(C)C1=CC=CC=C1 |
| Synonym | sec-butylbenzene,2-phenylbutane,1-methylpropyl benzene,secondary butylbenzene,benzene, 1-methylpropyl,s-butylbenzene,benzene, sec-butyl,1-sec-butylbenzene,methylpropyl benzene,secbutylbenzene |
| IUPAC Name | butan-2-ylbenzene |
| InChI Key | ZJMWRROPUADPEA-UHFFFAOYSA-N |
| Molecular Formula | C10H14 |
2-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)benzyl Bromide 98.0+%, TCI America™
CAS: 377780-72-8 Molecular Formula: C13H18BBrO2 Molecular Weight (g/mol): 296.999 MDL Number: MFCD01632210 InChI Key: ROIXSNLOYHDYBP-UHFFFAOYSA-N Synonym: 2-2-bromomethyl phenyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane,2-bromomethylphenylboronic acid pinacol ester,2-bromomethyl benzeneboronic acid, pinacol ester,2-bromomethylphenylboronic acid, pinacol ester,2-bromomethyl benzeneboronic acid pinacol ester,2-bromomethylphenyl boronic acid, pinacol ester,amtb373,2-bromomethyl phenylboronic pinacol ester,2-bromoethylphenylboronic acid pinacol ester PubChem CID: 3834834 IUPAC Name: 2-[2-(bromomethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane SMILES: B1(OC(C(O1)(C)C)(C)C)C2=CC=CC=C2CBr
| PubChem CID | 3834834 |
|---|---|
| CAS | 377780-72-8 |
| Molecular Weight (g/mol) | 296.999 |
| MDL Number | MFCD01632210 |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=CC=C2CBr |
| Synonym | 2-2-bromomethyl phenyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane,2-bromomethylphenylboronic acid pinacol ester,2-bromomethyl benzeneboronic acid, pinacol ester,2-bromomethylphenylboronic acid, pinacol ester,2-bromomethyl benzeneboronic acid pinacol ester,2-bromomethylphenyl boronic acid, pinacol ester,amtb373,2-bromomethyl phenylboronic pinacol ester,2-bromoethylphenylboronic acid pinacol ester |
| IUPAC Name | 2-[2-(bromomethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChI Key | ROIXSNLOYHDYBP-UHFFFAOYSA-N |
| Molecular Formula | C13H18BBrO2 |